C19H31Hg — CID 145462727
[(10Z,12E,14Z)-nonadeca-1,10,12,14-tetraen-2-yl]mercury (PubChem CID 145462727) has the molecular formula C19H31Hg and a molecular weight of 460.05 g/mol. Its IUPAC name is [(10Z,12E,14Z)-nonadeca-1,10,12,14-tetraen-2-yl]mercury.
| Compound Name | [(10Z,12E,14Z)-nonadeca-1,10,12,14-tetraen-2-yl]mercury |
|---|---|
| PubChem CID | 145462727 |
| Molecular Formula | C19H31Hg |
| Molecular Weight | 460.05 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | [(10Z,12E,14Z)-nonadeca-1,10,12,14-tetraen-2-yl]mercury |
| SMILES | C=C([Hg])CCCCCCC/C=C\C=C\C=C/CCCC |
| InChI | InChI=1S/C19H31.Hg/c1-3-5-7-9-11-13-15-17-19-18-16-14-12-10-8-6-4-2;/h10,12,14,16,18-19H,1,4-9,11,13,15,17H2,2H3;/b12-10-,16-14+,19-18-; |
| InChIKey | VWWQZWDRJPDKBI-DPILOBPJSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.05 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|