C14H20O5 — CID 139813864
4-O-[(2Z,4E)-2-hydroxynona-2,4-dienyl] 1-O-methyl (Z)-but-2-enedioate (PubChem CID 139813864) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is 4-O-[(2Z,4E)-2-hydroxynona-2,4-dienyl] 1-O-methyl (Z)-but-2-enedioate.
| Compound Name | 4-O-[(2Z,4E)-2-hydroxynona-2,4-dienyl] 1-O-methyl (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 139813864 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-O-[(2Z,4E)-2-hydroxynona-2,4-dienyl] 1-O-methyl (Z)-but-2-enedioate |
| SMILES | CCCC/C=C/C=C(\O)COC(=O)/C=C\C(=O)OC |
| InChI | InChI=1S/C14H20O5/c1-3-4-5-6-7-8-12(15)11-19-14(17)10-9-13(16)18-2/h6-10,15H,3-5,11H2,1-2H3/b7-6+,10-9-,12-8- |
| InChIKey | KTSUOMPHXYFQPZ-LMDBGGMASA-N |
| XLogP | 2.45 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|