About methyl (E)-hept-2-enoate
methyl (E)-hept-2-enoate (PubChem CID 5368087) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is methyl (E)-hept-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-hept-2-enoate |
| PubChem CID | 5368087 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | methyl (E)-hept-2-enoate |
| SMILES | CCCC/C=C/C(=O)OC |
| InChI | InChI=1S/C8H14O2/c1-3-4-5-6-7-8(9)10-2/h6-7H,3-5H2,1-2H3/b7-6+ |
| InChIKey | IQQDLHGWGKEQDS-VOTSOKGWSA-N |
| XLogP | 1.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-hept-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-hept-2-enoate?
The IUPAC name of methyl (E)-hept-2-enoate (CID 5368087) is methyl (E)-hept-2-enoate.
What is the SMILES notation for methyl (E)-hept-2-enoate?
The canonical SMILES for methyl (E)-hept-2-enoate is CCCC/C=C/C(=O)OC.
What is the InChIKey of methyl (E)-hept-2-enoate?
The InChIKey is IQQDLHGWGKEQDS-VOTSOKGWSA-N. The full InChI is InChI=1S/C8H14O2/c1-3-4-5-6-7-8(9)10-2/h6-7H,3-5H2,1-2H3/b7-6+.
What are the key properties of methyl (E)-hept-2-enoate?
methyl (E)-hept-2-enoate has a molecular weight of 142.20 g/mol, XLogP of 1.91, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-hept-2-enoate is sourced from PubChem (CID 5368087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).