C35H64O3 — CID 157382791
(Z)-hexadec-9-enal;methyl (2E,11Z)-octadeca-2,11-dienoate (PubChem CID 157382791) has the molecular formula C35H64O3 and a molecular weight of 532.89 g/mol. Its IUPAC name is (Z)-hexadec-9-enal;methyl (2E,11Z)-octadeca-2,11-dienoate.
| Compound Name | (Z)-hexadec-9-enal;methyl (2E,11Z)-octadeca-2,11-dienoate |
|---|---|
| PubChem CID | 157382791 |
| Molecular Formula | C35H64O3 |
| Molecular Weight | 532.89 g/mol |
| Exact Mass | 532.49 |
| IUPAC Name | (Z)-hexadec-9-enal;methyl (2E,11Z)-octadeca-2,11-dienoate |
| SMILES | CCCCCC/C=C\CCCCCCC/C=C/C(=O)OC.CCCCCC/C=C\CCCCCCCC=O |
| InChI | InChI=1S/C19H34O2.C16H30O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17/h8-9,17-18H,3-7,10-16H2,1-2H3;7-8,16H,2-6,9-15H2,1H3/b9-8-,18-17+;8-7- |
| InChIKey | BLBUUHLYZGQDQZ-MFPHRQSJSA-N |
| XLogP | 11.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.89 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|