C13H22O2 — CID 54309324
2-propyldeca-2,4-dienoic acid (PubChem CID 54309324) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-propyldeca-2,4-dienoic acid.
| Compound Name | 2-propyldeca-2,4-dienoic acid |
|---|---|
| PubChem CID | 54309324 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 2-propyldeca-2,4-dienoic acid |
| SMILES | CCCCCC=CC=C(CCC)C(=O)O |
| InChI | InChI=1S/C13H22O2/c1-3-5-6-7-8-9-11-12(10-4-2)13(14)15/h8-9,11H,3-7,10H2,1-2H3,(H,14,15) |
| InChIKey | SJTVSAOLSWHVBM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|