C7H10FN — CID 165151838
N-[(1E,3E)-2-fluorohexa-1,3-dienyl]methanimine (PubChem CID 165151838) has the molecular formula C7H10FN and a molecular weight of 127.16 g/mol. Its IUPAC name is N-[(1E,3E)-2-fluorohexa-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3E)-2-fluorohexa-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 165151838 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | N-[(1E,3E)-2-fluorohexa-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(F)\C=C\CC |
| InChI | InChI=1S/C7H10FN/c1-3-4-5-7(8)6-9-2/h4-6H,2-3H2,1H3/b5-4+,7-6+ |
| InChIKey | VPXVWWPVUAHTDR-YTXTXJHMSA-N |
| XLogP | 2.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|