About N'-[[[(3Z)-hexa-1,3-dien-2-yl]-methylamino]-methylamino]-N-methylidenemethanimidamide
N'-[[[(3Z)-hexa-1,3-dien-2-yl]-methylamino]-methylamino]-N-methylidenemethanimidamide (PubChem CID 174101511) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is N'-[[[(3Z)-hexa-1,3-dien-2-yl]-methylamino]-methylamino]-N-methylidenemethanimidamide.
Molecular Properties
| Compound Name | N'-[[[(3Z)-hexa-1,3-dien-2-yl]-methylamino]-methylamino]-N-methylidenemethanimidamide |
| PubChem CID | 174101511 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | N'-[[[(3Z)-hexa-1,3-dien-2-yl]-methylamino]-methylamino]-N-methylidenemethanimidamide |
| SMILES | C=NC=NN(C)N(C)C(=C)/C=C\CC |
| InChI | InChI=1S/C10H18N4/c1-6-7-8-10(2)13(4)14(5)12-9-11-3/h7-9H,2-3,6H2,1,4-5H3/b8-7-,12-9? |
| InChIKey | WVIUWLPXUVXRER-JEOSXAEBSA-N |
| XLogP | 1.89 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-[[[(3Z)-hexa-1,3-dien-2-yl]-methylamino]-methylamino]-N-methylidenemethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[[(3Z)-hexa-1,3-dien-2-yl]-methylamino]-methylamino]-N-methylidenemethanimidamide?
The IUPAC name of N'-[[[(3Z)-hexa-1,3-dien-2-yl]-methylamino]-methylamino]-N-methylidenemethanimidamide (CID 174101511) is N'-[[[(3Z)-hexa-1,3-dien-2-yl]-methylamino]-methylamino]-N-methylidenemethanimidamide.
What is the SMILES notation for N'-[[[(3Z)-hexa-1,3-dien-2-yl]-methylamino]-methylamino]-N-methylidenemethanimidamide?
The canonical SMILES for N'-[[[(3Z)-hexa-1,3-dien-2-yl]-methylamino]-methylamino]-N-methylidenemethanimidamide is C=NC=NN(C)N(C)C(=C)/C=C\CC.
What is the InChIKey of N'-[[[(3Z)-hexa-1,3-dien-2-yl]-methylamino]-methylamino]-N-methylidenemethanimidamide?
The InChIKey is WVIUWLPXUVXRER-JEOSXAEBSA-N. The full InChI is InChI=1S/C10H18N4/c1-6-7-8-10(2)13(4)14(5)12-9-11-3/h7-9H,2-3,6H2,1,4-5H3/b8-7-,12-9?.
What are the key properties of N'-[[[(3Z)-hexa-1,3-dien-2-yl]-methylamino]-methylamino]-N-methylidenemethanimidamide?
N'-[[[(3Z)-hexa-1,3-dien-2-yl]-methylamino]-methylamino]-N-methylidenemethanimidamide has a molecular weight of 194.28 g/mol, XLogP of 1.89, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[[(3Z)-hexa-1,3-dien-2-yl]-methylamino]-methylamino]-N-methylidenemethanimidamide is sourced from PubChem (CID 174101511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).