C10H18N4 — CID 174101511
N'-[[[(3Z)-hexa-1,3-dien-2-yl]-methylamino]-methylamino]-N-methylidenemethanimidamide (PubChem CID 174101511) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is N'-[[[(3Z)-hexa-1,3-dien-2-yl]-methylamino]-methylamino]-N-methylidenemethanimidamide.
| Compound Name | N'-[[[(3Z)-hexa-1,3-dien-2-yl]-methylamino]-methylamino]-N-methylidenemethanimidamide |
|---|---|
| PubChem CID | 174101511 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | N'-[[[(3Z)-hexa-1,3-dien-2-yl]-methylamino]-methylamino]-N-methylidenemethanimidamide |
| SMILES | C=NC=NN(C)N(C)C(=C)/C=C\CC |
| InChI | InChI=1S/C10H18N4/c1-6-7-8-10(2)13(4)14(5)12-9-11-3/h7-9H,2-3,6H2,1,4-5H3/b8-7-,12-9? |
| InChIKey | WVIUWLPXUVXRER-JEOSXAEBSA-N |
| XLogP | 1.89 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|