C9H17NOS — CID 143296475
(2E,4Z)-N,N-dimethylhepta-2,4-diene-3-sulfinamide (PubChem CID 143296475) has the molecular formula C9H17NOS and a molecular weight of 187.31 g/mol. Its IUPAC name is (2E,4Z)-N,N-dimethylhepta-2,4-diene-3-sulfinamide.
| Compound Name | (2E,4Z)-N,N-dimethylhepta-2,4-diene-3-sulfinamide |
|---|---|
| PubChem CID | 143296475 |
| Molecular Formula | C9H17NOS |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | (2E,4Z)-N,N-dimethylhepta-2,4-diene-3-sulfinamide |
| SMILES | C/C=C(\C=C/CC)S(=O)N(C)C |
| InChI | InChI=1S/C9H17NOS/c1-5-7-8-9(6-2)12(11)10(3)4/h6-8H,5H2,1-4H3/b8-7-,9-6+ |
| InChIKey | HPIGRUHHTCHCEL-SOKJVCRVSA-N |
| XLogP | 2.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|