C11H19NO — CID 123470734
(2Z,5Z)-1-(dimethylamino)-3-methylocta-2,5-dien-4-one (PubChem CID 123470734) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (2Z,5Z)-1-(dimethylamino)-3-methylocta-2,5-dien-4-one.
| Compound Name | (2Z,5Z)-1-(dimethylamino)-3-methylocta-2,5-dien-4-one |
|---|---|
| PubChem CID | 123470734 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (2Z,5Z)-1-(dimethylamino)-3-methylocta-2,5-dien-4-one |
| SMILES | CC/C=C\C(=O)/C(C)=C\CN(C)C |
| InChI | InChI=1S/C11H19NO/c1-5-6-7-11(13)10(2)8-9-12(3)4/h6-8H,5,9H2,1-4H3/b7-6-,10-8- |
| InChIKey | YFUWWCIBKRKCEN-INZNQPOWSA-N |
| XLogP | 2.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|