About ethyl (E)-4-(dimethylamino)-2-methylbut-2-enoate;formaldehyde;propane
ethyl (E)-4-(dimethylamino)-2-methylbut-2-enoate;formaldehyde;propane (PubChem CID 143023686) has the molecular formula C13H27NO3
and a molecular weight of 245.36 g/mol. Its IUPAC name is ethyl (E)-4-(dimethylamino)-2-methylbut-2-enoate;formaldehyde;propane.
Molecular Properties
| Compound Name | ethyl (E)-4-(dimethylamino)-2-methylbut-2-enoate;formaldehyde;propane |
| PubChem CID | 143023686 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | ethyl (E)-4-(dimethylamino)-2-methylbut-2-enoate;formaldehyde;propane |
| SMILES | C=O.CCC.CCOC(=O)/C(C)=C/CN(C)C |
| InChI | InChI=1S/C9H17NO2.C3H8.CH2O/c1-5-12-9(11)8(2)6-7-10(3)4;1-3-2;1-2/h6H,5,7H2,1-4H3;3H2,1-2H3;1H2/b8-6+;; |
| InChIKey | QJCFDMPKOYLPQI-OVGXCEQFSA-N |
| XLogP | 2.29 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-4-(dimethylamino)-2-methylbut-2-enoate;formaldehyde;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-4-(dimethylamino)-2-methylbut-2-enoate;formaldehyde;propane?
The IUPAC name of ethyl (E)-4-(dimethylamino)-2-methylbut-2-enoate;formaldehyde;propane (CID 143023686) is ethyl (E)-4-(dimethylamino)-2-methylbut-2-enoate;formaldehyde;propane.
What is the SMILES notation for ethyl (E)-4-(dimethylamino)-2-methylbut-2-enoate;formaldehyde;propane?
The canonical SMILES for ethyl (E)-4-(dimethylamino)-2-methylbut-2-enoate;formaldehyde;propane is C=O.CCC.CCOC(=O)/C(C)=C/CN(C)C.
What is the InChIKey of ethyl (E)-4-(dimethylamino)-2-methylbut-2-enoate;formaldehyde;propane?
The InChIKey is QJCFDMPKOYLPQI-OVGXCEQFSA-N. The full InChI is InChI=1S/C9H17NO2.C3H8.CH2O/c1-5-12-9(11)8(2)6-7-10(3)4;1-3-2;1-2/h6H,5,7H2,1-4H3;3H2,1-2H3;1H2/b8-6+;;.
What are the key properties of ethyl (E)-4-(dimethylamino)-2-methylbut-2-enoate;formaldehyde;propane?
ethyl (E)-4-(dimethylamino)-2-methylbut-2-enoate;formaldehyde;propane has a molecular weight of 245.36 g/mol, XLogP of 2.29, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-4-(dimethylamino)-2-methylbut-2-enoate;formaldehyde;propane is sourced from PubChem (CID 143023686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).