About ethyl (E)-4-bromo-2-methylbut-2-enoate;methane
ethyl (E)-4-bromo-2-methylbut-2-enoate;methane (PubChem CID 158230787) has the molecular formula C9H19BrO2
and a molecular weight of 239.15 g/mol. Its IUPAC name is ethyl (E)-4-bromo-2-methylbut-2-enoate;methane.
Molecular Properties
| Compound Name | ethyl (E)-4-bromo-2-methylbut-2-enoate;methane |
| PubChem CID | 158230787 |
| Molecular Formula | C9H19BrO2 |
| Molecular Weight | 239.15 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | ethyl (E)-4-bromo-2-methylbut-2-enoate;methane |
| SMILES | C.C.CCOC(=O)/C(C)=C/CBr |
| InChI | InChI=1S/C7H11BrO2.2CH4/c1-3-10-7(9)6(2)4-5-8;;/h4H,3,5H2,1-2H3;2*1H4/b6-4+;; |
| InChIKey | GEIYPWMFEUMMHA-SLNOCBGISA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.15 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-4-bromo-2-methylbut-2-enoate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-4-bromo-2-methylbut-2-enoate;methane?
The IUPAC name of ethyl (E)-4-bromo-2-methylbut-2-enoate;methane (CID 158230787) is ethyl (E)-4-bromo-2-methylbut-2-enoate;methane.
What is the SMILES notation for ethyl (E)-4-bromo-2-methylbut-2-enoate;methane?
The canonical SMILES for ethyl (E)-4-bromo-2-methylbut-2-enoate;methane is C.C.CCOC(=O)/C(C)=C/CBr.
What is the InChIKey of ethyl (E)-4-bromo-2-methylbut-2-enoate;methane?
The InChIKey is GEIYPWMFEUMMHA-SLNOCBGISA-N. The full InChI is InChI=1S/C7H11BrO2.2CH4/c1-3-10-7(9)6(2)4-5-8;;/h4H,3,5H2,1-2H3;2*1H4/b6-4+;;.
What are the key properties of ethyl (E)-4-bromo-2-methylbut-2-enoate;methane?
ethyl (E)-4-bromo-2-methylbut-2-enoate;methane has a molecular weight of 239.15 g/mol, XLogP of 3.16, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-4-bromo-2-methylbut-2-enoate;methane is sourced from PubChem (CID 158230787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).