C10H20BrN — CID 142309153
bromomethane;(2Z,4Z)-N,N-dimethylhepta-2,4-dien-1-amine (PubChem CID 142309153) has the molecular formula C10H20BrN and a molecular weight of 234.18 g/mol. Its IUPAC name is bromomethane;(2Z,4Z)-N,N-dimethylhepta-2,4-dien-1-amine.
| Compound Name | bromomethane;(2Z,4Z)-N,N-dimethylhepta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142309153 |
| Molecular Formula | C10H20BrN |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | bromomethane;(2Z,4Z)-N,N-dimethylhepta-2,4-dien-1-amine |
| SMILES | CBr.CC/C=C\C=C/CN(C)C |
| InChI | InChI=1S/C9H17N.CH3Br/c1-4-5-6-7-8-9-10(2)3;1-2/h5-8H,4,9H2,1-3H3;1H3/b6-5-,8-7-; |
| InChIKey | KOJPBSUXLYSNNW-OICKEEGDSA-N |
| XLogP | 3.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|