C7H16ClN — CID 155386408
(E)-N,N-dimethylpent-2-en-1-amine;hydrochloride (PubChem CID 155386408) has the molecular formula C7H16ClN and a molecular weight of 149.66 g/mol. Its IUPAC name is (E)-N,N-dimethylpent-2-en-1-amine;hydrochloride.
| Compound Name | (E)-N,N-dimethylpent-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 155386408 |
| Molecular Formula | C7H16ClN |
| Molecular Weight | 149.66 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | (E)-N,N-dimethylpent-2-en-1-amine;hydrochloride |
| SMILES | CC/C=C/CN(C)C.Cl |
| InChI | InChI=1S/C7H15N.ClH/c1-4-5-6-7-8(2)3;/h5-6H,4,7H2,1-3H3;1H/b6-5+; |
| InChIKey | ALLCSPRSVWEZJG-IPZCTEOASA-N |
| XLogP | 1.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.66 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|