C9H19N — CID 5365213
(Z)-N,N-diethylpent-2-en-1-amine (PubChem CID 5365213) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is (Z)-N,N-diethylpent-2-en-1-amine.
| Compound Name | (Z)-N,N-diethylpent-2-en-1-amine |
|---|---|
| PubChem CID | 5365213 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | (Z)-N,N-diethylpent-2-en-1-amine |
| SMILES | CC/C=C\CN(CC)CC |
| InChI | InChI=1S/C9H19N/c1-4-7-8-9-10(5-2)6-3/h7-8H,4-6,9H2,1-3H3/b8-7- |
| InChIKey | GNERVRYWRNXNQS-FPLPWBNLSA-N |
| XLogP | 2.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|