C9H13N — CID 163670390
(2Z)-N,N-dimethylhepta-2,4-dien-6-yn-1-amine (PubChem CID 163670390) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is (2Z)-N,N-dimethylhepta-2,4-dien-6-yn-1-amine.
| Compound Name | (2Z)-N,N-dimethylhepta-2,4-dien-6-yn-1-amine |
|---|---|
| PubChem CID | 163670390 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | (2Z)-N,N-dimethylhepta-2,4-dien-6-yn-1-amine |
| SMILES | C#CC=C/C=C\CN(C)C |
| InChI | InChI=1S/C9H13N/c1-4-5-6-7-8-9-10(2)3/h1,5-8H,9H2,2-3H3/b6-5?,8-7- |
| InChIKey | OUKMJKWBKOPWQT-DTYAYTLWSA-N |
| XLogP | 1.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|