C17H23N — CID 145212065
(2E,4Z,6Z)-2-methyl-N-[(3Z,5Z)-octa-3,5-dien-7-ynyl]octa-2,4,6-trien-1-amine (PubChem CID 145212065) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is (2E,4Z,6Z)-2-methyl-N-[(3Z,5Z)-octa-3,5-dien-7-ynyl]octa-2,4,6-trien-1-amine.
| Compound Name | (2E,4Z,6Z)-2-methyl-N-[(3Z,5Z)-octa-3,5-dien-7-ynyl]octa-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 145212065 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | (2E,4Z,6Z)-2-methyl-N-[(3Z,5Z)-octa-3,5-dien-7-ynyl]octa-2,4,6-trien-1-amine |
| SMILES | C#C/C=C\C=C/CCNC/C(C)=C/C=C\C=C/C |
| InChI | InChI=1S/C17H23N/c1-4-6-8-10-11-13-15-18-16-17(3)14-12-9-7-5-2/h1,5-12,14,18H,13,15-16H2,2-3H3/b7-5-,8-6-,11-10-,12-9-,17-14+ |
| InChIKey | WBXSJWSCXWXXMY-FWYVYGKVSA-N |
| XLogP | 3.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|