C14H23N — CID 145042717
(4Z,6Z)-N-[(E)-2-methylbut-2-enyl]-3-methylideneocta-4,6-dien-1-amine (PubChem CID 145042717) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (4Z,6Z)-N-[(E)-2-methylbut-2-enyl]-3-methylideneocta-4,6-dien-1-amine.
| Compound Name | (4Z,6Z)-N-[(E)-2-methylbut-2-enyl]-3-methylideneocta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 145042717 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (4Z,6Z)-N-[(E)-2-methylbut-2-enyl]-3-methylideneocta-4,6-dien-1-amine |
| SMILES | C=C(/C=C\C=C/C)CCNC/C(C)=C/C |
| InChI | InChI=1S/C14H23N/c1-5-7-8-9-14(4)10-11-15-12-13(3)6-2/h5-9,15H,4,10-12H2,1-3H3/b7-5-,9-8-,13-6+ |
| InChIKey | TWRYKMRTIIMWQD-GUCZFXPMSA-N |
| XLogP | 3.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|