C8H11Cl — CID 143341887
(3Z,5Z)-2-(chloromethyl)hepta-1,3,5-triene (PubChem CID 143341887) has the molecular formula C8H11Cl and a molecular weight of 142.63 g/mol. Its IUPAC name is (3Z,5Z)-2-(chloromethyl)hepta-1,3,5-triene.
| Compound Name | (3Z,5Z)-2-(chloromethyl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 143341887 |
| Molecular Formula | C8H11Cl |
| Molecular Weight | 142.63 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | (3Z,5Z)-2-(chloromethyl)hepta-1,3,5-triene |
| SMILES | C=C(/C=C\C=C/C)CCl |
| InChI | InChI=1S/C8H11Cl/c1-3-4-5-6-8(2)7-9/h3-6H,2,7H2,1H3/b4-3-,6-5- |
| InChIKey | IKKVQWNNNABCNS-OUPQRBNQSA-N |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.63 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|