C14H26O — CID 177053569
ethane;(5Z,7Z)-4-methylidenenona-5,7-dien-3-one (PubChem CID 177053569) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is ethane;(5Z,7Z)-4-methylidenenona-5,7-dien-3-one.
| Compound Name | ethane;(5Z,7Z)-4-methylidenenona-5,7-dien-3-one |
|---|---|
| PubChem CID | 177053569 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | ethane;(5Z,7Z)-4-methylidenenona-5,7-dien-3-one |
| SMILES | C=C(/C=C\C=C/C)C(=O)CC.CC.CC |
| InChI | InChI=1S/C10H14O.2C2H6/c1-4-6-7-8-9(3)10(11)5-2;2*1-2/h4,6-8H,3,5H2,1-2H3;2*1-2H3/b6-4-,8-7-;; |
| InChIKey | NMGSHLLPXLAHCQ-GTWMBCDHSA-N |
| XLogP | 4.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|