C16H30N2O3 — CID 145216550
ethane;(2R)-2-(methylamino)-3-[[(3Z,5E)-2-methylidenehepta-3,5-dienoyl]amino]propanoic acid (PubChem CID 145216550) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is ethane;(2R)-2-(methylamino)-3-[[(3Z,5E)-2-methylidenehepta-3,5-dienoyl]amino]propanoic acid.
| Compound Name | ethane;(2R)-2-(methylamino)-3-[[(3Z,5E)-2-methylidenehepta-3,5-dienoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 145216550 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | ethane;(2R)-2-(methylamino)-3-[[(3Z,5E)-2-methylidenehepta-3,5-dienoyl]amino]propanoic acid |
| SMILES | C=C(/C=C\C=C\C)C(=O)NC[C@@H](NC)C(=O)O.CC.CC |
| InChI | InChI=1S/C12H18N2O3.2C2H6/c1-4-5-6-7-9(2)11(15)14-8-10(13-3)12(16)17;2*1-2/h4-7,10,13H,2,8H2,1,3H3,(H,14,15)(H,16,17);2*1-2H3/b5-4+,7-6-;;/t10-;;/m1../s1 |
| InChIKey | AYIDMTMNMMGUMK-ZNPODUCASA-N |
| XLogP | 2.52 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|