C7H15N3O3 — CID 121428706
(2R)-3-(3-aminopropanoylamino)-2-(methylamino)propanoic acid (PubChem CID 121428706) has the molecular formula C7H15N3O3 and a molecular weight of 189.21 g/mol. Its IUPAC name is (2R)-3-(3-aminopropanoylamino)-2-(methylamino)propanoic acid.
| Compound Name | (2R)-3-(3-aminopropanoylamino)-2-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 121428706 |
| Molecular Formula | C7H15N3O3 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | (2R)-3-(3-aminopropanoylamino)-2-(methylamino)propanoic acid |
| SMILES | CN[C@H](CNC(=O)CCN)C(=O)O |
| InChI | InChI=1S/C7H15N3O3/c1-9-5(7(12)13)4-10-6(11)2-3-8/h5,9H,2-4,8H2,1H3,(H,10,11)(H,12,13)/t5-/m1/s1 |
| InChIKey | AGSNLSKWNINPMS-RXMQYKEDSA-N |
| XLogP | -1.88 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |