About ethane;methane;(2Z,4Z)-6-methylideneocta-2,4-diene
ethane;methane;(2Z,4Z)-6-methylideneocta-2,4-diene (PubChem CID 143380166) has the molecular formula C12H24
and a molecular weight of 168.32 g/mol. Its IUPAC name is ethane;methane;(2Z,4Z)-6-methylideneocta-2,4-diene.
Molecular Properties
| Compound Name | ethane;methane;(2Z,4Z)-6-methylideneocta-2,4-diene |
| PubChem CID | 143380166 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | ethane;methane;(2Z,4Z)-6-methylideneocta-2,4-diene |
| SMILES | C.C=C(/C=C\C=C/C)CC.CC |
| InChI | InChI=1S/C9H14.C2H6.CH4/c1-4-6-7-8-9(3)5-2;1-2;/h4,6-8H,3,5H2,1-2H3;1-2H3;1H4/b6-4-,8-7-;; |
| InChIKey | FWJLGEKBXMKTPL-GTWMBCDHSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;methane;(2Z,4Z)-6-methylideneocta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;(2Z,4Z)-6-methylideneocta-2,4-diene?
The IUPAC name of ethane;methane;(2Z,4Z)-6-methylideneocta-2,4-diene (CID 143380166) is ethane;methane;(2Z,4Z)-6-methylideneocta-2,4-diene.
What is the SMILES notation for ethane;methane;(2Z,4Z)-6-methylideneocta-2,4-diene?
The canonical SMILES for ethane;methane;(2Z,4Z)-6-methylideneocta-2,4-diene is C.C=C(/C=C\C=C/C)CC.CC.
What is the InChIKey of ethane;methane;(2Z,4Z)-6-methylideneocta-2,4-diene?
The InChIKey is FWJLGEKBXMKTPL-GTWMBCDHSA-N. The full InChI is InChI=1S/C9H14.C2H6.CH4/c1-4-6-7-8-9(3)5-2;1-2;/h4,6-8H,3,5H2,1-2H3;1-2H3;1H4/b6-4-,8-7-;;.
What are the key properties of ethane;methane;(2Z,4Z)-6-methylideneocta-2,4-diene?
ethane;methane;(2Z,4Z)-6-methylideneocta-2,4-diene has a molecular weight of 168.32 g/mol, XLogP of 4.75, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;(2Z,4Z)-6-methylideneocta-2,4-diene is sourced from PubChem (CID 143380166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).