C12H24 — CID 143380166
ethane;methane;(2Z,4Z)-6-methylideneocta-2,4-diene (PubChem CID 143380166) has the molecular formula C12H24 and a molecular weight of 168.32 g/mol. Its IUPAC name is ethane;methane;(2Z,4Z)-6-methylideneocta-2,4-diene.
| Compound Name | ethane;methane;(2Z,4Z)-6-methylideneocta-2,4-diene |
|---|---|
| PubChem CID | 143380166 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | ethane;methane;(2Z,4Z)-6-methylideneocta-2,4-diene |
| SMILES | C.C=C(/C=C\C=C/C)CC.CC |
| InChI | InChI=1S/C9H14.C2H6.CH4/c1-4-6-7-8-9(3)5-2;1-2;/h4,6-8H,3,5H2,1-2H3;1-2H3;1H4/b6-4-,8-7-;; |
| InChIKey | FWJLGEKBXMKTPL-GTWMBCDHSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|