C13H22 — CID 174375907
hexa-1,3-diene;4-methylidenehex-2-ene (PubChem CID 174375907) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is hexa-1,3-diene;4-methylidenehex-2-ene.
| Compound Name | hexa-1,3-diene;4-methylidenehex-2-ene |
|---|---|
| PubChem CID | 174375907 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | hexa-1,3-diene;4-methylidenehex-2-ene |
| SMILES | C=C(C=CC)CC.C=CC=CCC |
| InChI | InChI=1S/C7H12.C6H10/c1-4-6-7(3)5-2;1-3-5-6-4-2/h4,6H,3,5H2,1-2H3;3,5-6H,1,4H2,2H3 |
| InChIKey | KHNQMWGTTAJQFI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|