C14H22O — CID 143012341
(3E,5Z)-3-[(Z)-2-methylidenepent-3-enoxy]octa-3,5-diene (PubChem CID 143012341) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is (3E,5Z)-3-[(Z)-2-methylidenepent-3-enoxy]octa-3,5-diene.
| Compound Name | (3E,5Z)-3-[(Z)-2-methylidenepent-3-enoxy]octa-3,5-diene |
|---|---|
| PubChem CID | 143012341 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (3E,5Z)-3-[(Z)-2-methylidenepent-3-enoxy]octa-3,5-diene |
| SMILES | C=C(/C=C\C)CO/C(=C/C=C\CC)CC |
| InChI | InChI=1S/C14H22O/c1-5-8-9-11-14(7-3)15-12-13(4)10-6-2/h6,8-11H,4-5,7,12H2,1-3H3/b9-8-,10-6-,14-11+ |
| InChIKey | NXWZKOAQUHUTFP-XJIMGXMFSA-N |
| XLogP | 4.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|