C11H16O5 — CID 129317620
5-(2-ethoxy-2-oxoethoxy)hepta-2,4-dienoic acid (PubChem CID 129317620) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is 5-(2-ethoxy-2-oxoethoxy)hepta-2,4-dienoic acid.
| Compound Name | 5-(2-ethoxy-2-oxoethoxy)hepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 129317620 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 5-(2-ethoxy-2-oxoethoxy)hepta-2,4-dienoic acid |
| SMILES | CCOC(=O)COC(=CC=CC(=O)O)CC |
| InChI | InChI=1S/C11H16O5/c1-3-9(6-5-7-10(12)13)16-8-11(14)15-4-2/h5-7H,3-4,8H2,1-2H3,(H,12,13) |
| InChIKey | IDZDEHUYGUQSEV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|