2-(2-ethoxy-2-oxoethoxy)acetic acid

C6H10O5 — CID 11305696

IUPAC2-(2-ethoxy-2-oxoethoxy)acetic acid
SMILESCCOC(=O)COCC(=O)O
InChIInChI=1S/C6H10O5/c1-2-11-6(9)4-10-3-5(7)8/h2-4H2,1H3,(H,7,8)
InChIKeyTVRDZOYLTRJNII-UHFFFAOYSA-N
MW162.14 g/mol
LogP-0.35
Rot. Bonds5

About 2-(2-ethoxy-2-oxoethoxy)acetic acid

2-(2-ethoxy-2-oxoethoxy)acetic acid (PubChem CID 11305696) has the molecular formula C6H10O5 and a molecular weight of 162.14 g/mol. Its IUPAC name is 2-(2-ethoxy-2-oxoethoxy)acetic acid.

Molecular Properties

Compound Name2-(2-ethoxy-2-oxoethoxy)acetic acid
PubChem CID11305696
Molecular FormulaC6H10O5
Molecular Weight162.14 g/mol
Exact Mass162.05
IUPAC Name2-(2-ethoxy-2-oxoethoxy)acetic acid
SMILESCCOC(=O)COCC(=O)O
InChIInChI=1S/C6H10O5/c1-2-11-6(9)4-10-3-5(7)8/h2-4H2,1H3,(H,7,8)
InChIKeyTVRDZOYLTRJNII-UHFFFAOYSA-N
XLogP-0.35
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.14
LogP ≤ 5-0.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(2-ethoxy-2-oxoethoxy)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

benzene;ethyl 2-ethoxyacetate
CID 174867683
ethoxyethane;bis(ethyl 2-ethoxyacetate)
CID 160643191
2-[2-[(2-ethoxy-2-oxoethyl)-methylamino]-2-oxoethoxy]acetic acid
CID 115538733
ethyl 2-(2-ethoxy-2-sulfanylideneethoxy)acetate
CID 86595203
2-ethoxyacetic acid
CID 159744705
ethanol;ethyl 2-methoxyacetate;2-methoxyacetic acid
CID 159692110
ethyl 2-(2-methylbut-2-enoxy)acetate
CID 123178116
2-[2-[(2-ethoxy-2-oxoethyl)-propan-2-ylamino]-2-oxoethoxy]acetic acid
CID 61327891
3-(2-ethoxy-2-oxoethyl)peroxy-3-oxopropanoic acid
CID 87583890
carbonic acid;2-ethoxyacetic acid
CID 174869478
2-[2-[cyclopropyl-(2-ethoxy-2-oxoethyl)amino]-2-oxoethoxy]acetic acid
CID 61328078
ethyl 2-(2-sulfanylethoxy)acetate
CID 174809512

Frequently Asked Questions

What is the IUPAC name of 2-(2-ethoxy-2-oxoethoxy)acetic acid?
The IUPAC name of 2-(2-ethoxy-2-oxoethoxy)acetic acid (CID 11305696) is 2-(2-ethoxy-2-oxoethoxy)acetic acid.
What is the SMILES notation for 2-(2-ethoxy-2-oxoethoxy)acetic acid?
The canonical SMILES for 2-(2-ethoxy-2-oxoethoxy)acetic acid is CCOC(=O)COCC(=O)O.
What is the InChIKey of 2-(2-ethoxy-2-oxoethoxy)acetic acid?
The InChIKey is TVRDZOYLTRJNII-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O5/c1-2-11-6(9)4-10-3-5(7)8/h2-4H2,1H3,(H,7,8).
What are the key properties of 2-(2-ethoxy-2-oxoethoxy)acetic acid?
2-(2-ethoxy-2-oxoethoxy)acetic acid has a molecular weight of 162.14 g/mol, XLogP of -0.35, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethoxy-2-oxoethoxy)acetic acid is sourced from PubChem (CID 11305696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).