C11H19NO6 — CID 61327891
2-[2-[(2-ethoxy-2-oxoethyl)-propan-2-ylamino]-2-oxoethoxy]acetic acid (PubChem CID 61327891) has the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. Its IUPAC name is 2-[2-[(2-ethoxy-2-oxoethyl)-propan-2-ylamino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[(2-ethoxy-2-oxoethyl)-propan-2-ylamino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 61327891 |
| Molecular Formula | C11H19NO6 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2-[2-[(2-ethoxy-2-oxoethyl)-propan-2-ylamino]-2-oxoethoxy]acetic acid |
| SMILES | CCOC(=O)CN(C(=O)COCC(=O)O)C(C)C |
| InChI | InChI=1S/C11H19NO6/c1-4-18-11(16)5-12(8(2)3)9(13)6-17-7-10(14)15/h8H,4-7H2,1-3H3,(H,14,15) |
| InChIKey | DZUMHRILZMJUAZ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |