C14H21N — CID 155240504
(3Z,5Z)-N-methyl-N-[(3Z)-penta-1,3-dien-2-yl]octa-1,3,5-trien-2-amine (PubChem CID 155240504) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (3Z,5Z)-N-methyl-N-[(3Z)-penta-1,3-dien-2-yl]octa-1,3,5-trien-2-amine.
| Compound Name | (3Z,5Z)-N-methyl-N-[(3Z)-penta-1,3-dien-2-yl]octa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 155240504 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (3Z,5Z)-N-methyl-N-[(3Z)-penta-1,3-dien-2-yl]octa-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C\C)N(C)C(=C)/C=C\C=C/CC |
| InChI | InChI=1S/C14H21N/c1-6-8-9-10-12-14(4)15(5)13(3)11-7-2/h7-12H,3-4,6H2,1-2,5H3/b9-8-,11-7-,12-10- |
| InChIKey | HWLSVNYEPDAGCQ-XPVHWWMSSA-N |
| XLogP | 4.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|