C11H15F3 — CID 129041542
(2Z,4E,6E)-4-(1,1,2-trifluoroethyl)nona-2,4,6-triene (PubChem CID 129041542) has the molecular formula C11H15F3 and a molecular weight of 204.23 g/mol. Its IUPAC name is (2Z,4E,6E)-4-(1,1,2-trifluoroethyl)nona-2,4,6-triene.
| Compound Name | (2Z,4E,6E)-4-(1,1,2-trifluoroethyl)nona-2,4,6-triene |
|---|---|
| PubChem CID | 129041542 |
| Molecular Formula | C11H15F3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | (2Z,4E,6E)-4-(1,1,2-trifluoroethyl)nona-2,4,6-triene |
| SMILES | C/C=C\C(=C/C=C/CC)C(F)(F)CF |
| InChI | InChI=1S/C11H15F3/c1-3-5-6-8-10(7-4-2)11(13,14)9-12/h4-8H,3,9H2,1-2H3/b6-5+,7-4-,10-8+ |
| InChIKey | INOYPCGXTJHKAQ-VBIDDDQESA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|