C21H32F6 — CID 143322922
ethane;(2Z,4E,7E)-5-ethenyl-7-[(Z)-prop-1-enyl]-6,6-bis(trifluoromethyl)deca-2,4,7-triene (PubChem CID 143322922) has the molecular formula C21H32F6 and a molecular weight of 398.48 g/mol. Its IUPAC name is ethane;(2Z,4E,7E)-5-ethenyl-7-[(Z)-prop-1-enyl]-6,6-bis(trifluoromethyl)deca-2,4,7-triene.
| Compound Name | ethane;(2Z,4E,7E)-5-ethenyl-7-[(Z)-prop-1-enyl]-6,6-bis(trifluoromethyl)deca-2,4,7-triene |
|---|---|
| PubChem CID | 143322922 |
| Molecular Formula | C21H32F6 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | ethane;(2Z,4E,7E)-5-ethenyl-7-[(Z)-prop-1-enyl]-6,6-bis(trifluoromethyl)deca-2,4,7-triene |
| SMILES | C=C/C(=C\C=C/C)C(C(/C=C\C)=C/CC)(C(F)(F)F)C(F)(F)F.CC.CC |
| InChI | InChI=1S/C17H20F6.2C2H6/c1-5-9-12-13(8-4)15(16(18,19)20,17(21,22)23)14(10-6-2)11-7-3;2*1-2/h5-6,8-12H,4,7H2,1-3H3;2*1-2H3/b9-5-,10-6-,13-12+,14-11+;; |
| InChIKey | AOOAUFFITSCVEC-QDXRIPHGSA-N |
| XLogP | 8.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|