C17H24 — CID 151199646
6-but-3-en-2-ylidene-7-prop-1-enyldeca-2,4,7-triene (PubChem CID 151199646) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is 6-but-3-en-2-ylidene-7-prop-1-enyldeca-2,4,7-triene.
| Compound Name | 6-but-3-en-2-ylidene-7-prop-1-enyldeca-2,4,7-triene |
|---|---|
| PubChem CID | 151199646 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 6-but-3-en-2-ylidene-7-prop-1-enyldeca-2,4,7-triene |
| SMILES | C=CC(C)=C(C=CC=CC)C(C=CC)=CCC |
| InChI | InChI=1S/C17H24/c1-6-10-11-14-17(15(5)9-4)16(12-7-2)13-8-3/h6-7,9-14H,4,8H2,1-3,5H3 |
| InChIKey | NIAYNSLFXBEOBD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|