C16H22 — CID 166107909
(3Z,5Z,7Z)-5-ethenyl-3,6-dimethyl-4-[(Z)-prop-1-enyl]nona-1,3,5,7-tetraene (PubChem CID 166107909) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is (3Z,5Z,7Z)-5-ethenyl-3,6-dimethyl-4-[(Z)-prop-1-enyl]nona-1,3,5,7-tetraene.
| Compound Name | (3Z,5Z,7Z)-5-ethenyl-3,6-dimethyl-4-[(Z)-prop-1-enyl]nona-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 166107909 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (3Z,5Z,7Z)-5-ethenyl-3,6-dimethyl-4-[(Z)-prop-1-enyl]nona-1,3,5,7-tetraene |
| SMILES | C=C/C(C)=C(/C=C\C)C(\C=C)=C(C)/C=C\C |
| InChI | InChI=1S/C16H22/c1-7-11-14(6)15(10-4)16(12-8-2)13(5)9-3/h7-12H,3-4H2,1-2,5-6H3/b11-7-,12-8-,15-14-,16-13- |
| InChIKey | LDUJNGGONXOSLD-TVUFUVBOSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|