C13H18 — CID 143168001
(3E,5Z)-3-methyl-4-(3-methylbuta-1,3-dien-2-yl)hepta-1,3,5-triene (PubChem CID 143168001) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is (3E,5Z)-3-methyl-4-(3-methylbuta-1,3-dien-2-yl)hepta-1,3,5-triene.
| Compound Name | (3E,5Z)-3-methyl-4-(3-methylbuta-1,3-dien-2-yl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 143168001 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | (3E,5Z)-3-methyl-4-(3-methylbuta-1,3-dien-2-yl)hepta-1,3,5-triene |
| SMILES | C=C/C(C)=C(\C=C/C)C(=C)C(=C)C |
| InChI | InChI=1S/C13H18/c1-7-9-13(11(5)8-2)12(6)10(3)4/h7-9H,2-3,6H2,1,4-5H3/b9-7-,13-11+ |
| InChIKey | VZWCVFPVMSCUDE-OJNBOFHUSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|