C14H25N — CID 143773644
(4Z)-N,5-dimethyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-imine;ethane (PubChem CID 143773644) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is (4Z)-N,5-dimethyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-imine;ethane.
| Compound Name | (4Z)-N,5-dimethyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-imine;ethane |
|---|---|
| PubChem CID | 143773644 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (4Z)-N,5-dimethyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-imine;ethane |
| SMILES | C=C/C(C)=C(/C=C\C)C(\CC)=N\C.CC |
| InChI | InChI=1S/C12H19N.C2H6/c1-6-9-11(10(4)7-2)12(8-3)13-5;1-2/h6-7,9H,2,8H2,1,3-5H3;1-2H3/b9-6-,11-10-,13-12+; |
| InChIKey | DLQJNBOLLFVZAM-XSMWJCOGSA-N |
| XLogP | 4.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|