C16H28 — CID 144627723
ethane;(3E,5Z)-4-ethenyl-5-ethylidene-3,7-dimethylocta-1,3-diene (PubChem CID 144627723) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is ethane;(3E,5Z)-4-ethenyl-5-ethylidene-3,7-dimethylocta-1,3-diene.
| Compound Name | ethane;(3E,5Z)-4-ethenyl-5-ethylidene-3,7-dimethylocta-1,3-diene |
|---|---|
| PubChem CID | 144627723 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | ethane;(3E,5Z)-4-ethenyl-5-ethylidene-3,7-dimethylocta-1,3-diene |
| SMILES | C=C/C(C)=C(C=C)/C(=C\C)CC(C)C.CC |
| InChI | InChI=1S/C14H22.C2H6/c1-7-12(6)14(9-3)13(8-2)10-11(4)5;1-2/h7-9,11H,1,3,10H2,2,4-6H3;1-2H3/b13-8-,14-12+; |
| InChIKey | SKGQSJKGTWETMX-CVORGUQQSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|