C16H32 — CID 143345850
ethane;(3Z)-4-ethyl-3,5,8-trimethylnona-1,3-diene (PubChem CID 143345850) has the molecular formula C16H32 and a molecular weight of 224.43 g/mol. Its IUPAC name is ethane;(3Z)-4-ethyl-3,5,8-trimethylnona-1,3-diene.
| Compound Name | ethane;(3Z)-4-ethyl-3,5,8-trimethylnona-1,3-diene |
|---|---|
| PubChem CID | 143345850 |
| Molecular Formula | C16H32 |
| Molecular Weight | 224.43 g/mol |
| Exact Mass | 224.25 |
| IUPAC Name | ethane;(3Z)-4-ethyl-3,5,8-trimethylnona-1,3-diene |
| SMILES | C=C/C(C)=C(/CC)C(C)CCC(C)C.CC |
| InChI | InChI=1S/C14H26.C2H6/c1-7-12(5)14(8-2)13(6)10-9-11(3)4;1-2/h7,11,13H,1,8-10H2,2-6H3;1-2H3/b14-12-; |
| InChIKey | XAHKDZBEWCOFKO-CTMPBGLUSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.43 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|