C20H30O — CID 144754217
(3Z)-6,9-dimethyl-2-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxy-5-methylidenedeca-1,3-diene (PubChem CID 144754217) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (3Z)-6,9-dimethyl-2-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxy-5-methylidenedeca-1,3-diene.
| Compound Name | (3Z)-6,9-dimethyl-2-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxy-5-methylidenedeca-1,3-diene |
|---|---|
| PubChem CID | 144754217 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (3Z)-6,9-dimethyl-2-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxy-5-methylidenedeca-1,3-diene |
| SMILES | C=C(C)/C=C\C(=C)OC(=C)/C=C\C(=C)C(C)CCC(C)C |
| InChI | InChI=1S/C20H30O/c1-15(2)9-11-17(5)18(6)12-14-20(8)21-19(7)13-10-16(3)4/h10,12-15,17H,3,6-9,11H2,1-2,4-5H3/b13-10-,14-12- |
| InChIKey | KTNPAMKEPOEZHA-TWCRNUMNSA-N |
| XLogP | 6.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|