C20H28F2O — CID 176948900
(3Z,7Z)-3,4-difluoro-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene (PubChem CID 176948900) has the molecular formula C20H28F2O and a molecular weight of 322.44 g/mol. Its IUPAC name is (3Z,7Z)-3,4-difluoro-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene.
| Compound Name | (3Z,7Z)-3,4-difluoro-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene |
|---|---|
| PubChem CID | 176948900 |
| Molecular Formula | C20H28F2O |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (3Z,7Z)-3,4-difluoro-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene |
| SMILES | C=C(/C=C\C(=C)C(C)CCC(C)C)C(=C)/C(F)=C(\F)C(=C)OC |
| InChI | InChI=1S/C20H28F2O/c1-13(2)9-10-14(3)15(4)11-12-16(5)17(6)19(21)20(22)18(7)23-8/h11-14H,4-7,9-10H2,1-3,8H3/b12-11-,20-19- |
| InChIKey | OUJGIPBGDLNTDX-KQERFQPYSA-N |
| XLogP | 6.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|