C30H38F4 — CID 143772648
(7Z,11Z,15Z)-7,8,15,16-tetrafluoro-18,21-dimethyl-6,9,10,13,14,17-hexamethylidenedocosa-1,7,11,15-tetraene (PubChem CID 143772648) has the molecular formula C30H38F4 and a molecular weight of 474.63 g/mol. Its IUPAC name is (7Z,11Z,15Z)-7,8,15,16-tetrafluoro-18,21-dimethyl-6,9,10,13,14,17-hexamethylidenedocosa-1,7,11,15-tetraene.
| Compound Name | (7Z,11Z,15Z)-7,8,15,16-tetrafluoro-18,21-dimethyl-6,9,10,13,14,17-hexamethylidenedocosa-1,7,11,15-tetraene |
|---|---|
| PubChem CID | 143772648 |
| Molecular Formula | C30H38F4 |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | (7Z,11Z,15Z)-7,8,15,16-tetrafluoro-18,21-dimethyl-6,9,10,13,14,17-hexamethylidenedocosa-1,7,11,15-tetraene |
| SMILES | C=CCCCC(=C)/C(F)=C(\F)C(=C)C(=C)/C=C\C(=C)C(=C)/C(F)=C(\F)C(=C)C(C)CCC(C)C |
| InChI | InChI=1S/C30H38F4/c1-11-12-13-14-23(7)27(31)28(32)24(8)21(5)17-18-22(6)26(10)30(34)29(33)25(9)20(4)16-15-19(2)3/h11,17-20H,1,5-10,12-16H2,2-4H3/b18-17-,28-27-,30-29- |
| InChIKey | BELORKWHYVZWBV-RDQLTGBFSA-N |
| XLogP | 10.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|