C29H36F4 — CID 143773258
(2E,7Z,11Z,15Z)-7,8,15,16-tetrafluoro-18-methyl-6,9,10,13,14,17-hexamethylidenedocosa-2,7,11,15-tetraene (PubChem CID 143773258) has the molecular formula C29H36F4 and a molecular weight of 460.60 g/mol. Its IUPAC name is (2E,7Z,11Z,15Z)-7,8,15,16-tetrafluoro-18-methyl-6,9,10,13,14,17-hexamethylidenedocosa-2,7,11,15-tetraene.
| Compound Name | (2E,7Z,11Z,15Z)-7,8,15,16-tetrafluoro-18-methyl-6,9,10,13,14,17-hexamethylidenedocosa-2,7,11,15-tetraene |
|---|---|
| PubChem CID | 143773258 |
| Molecular Formula | C29H36F4 |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | (2E,7Z,11Z,15Z)-7,8,15,16-tetrafluoro-18-methyl-6,9,10,13,14,17-hexamethylidenedocosa-2,7,11,15-tetraene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(F)=C(\F)C(=C)C(C)CCCC)C(=C)/C(F)=C(\F)C(=C)CC/C=C/C |
| InChI | InChI=1S/C29H36F4/c1-10-12-14-16-22(6)26(30)27(31)24(8)20(4)17-18-21(5)25(9)29(33)28(32)23(7)19(3)15-13-11-2/h10,12,17-19H,4-9,11,13-16H2,1-3H3/b12-10+,18-17-,27-26-,29-28- |
| InChIKey | RPRTVBOGEQJKMX-FDOGDSNMSA-N |
| XLogP | 10.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|