C33H44F4O — CID 143772829
(3Z,7Z,11Z)-3,4,11,12-tetrafluoro-14,17,18-trimethyl-5,6,9,10,13-pentamethylidene-2-prop-2-enoxydocosa-1,3,7,11-tetraene (PubChem CID 143772829) has the molecular formula C33H44F4O and a molecular weight of 532.71 g/mol. Its IUPAC name is (3Z,7Z,11Z)-3,4,11,12-tetrafluoro-14,17,18-trimethyl-5,6,9,10,13-pentamethylidene-2-prop-2-enoxydocosa-1,3,7,11-tetraene.
| Compound Name | (3Z,7Z,11Z)-3,4,11,12-tetrafluoro-14,17,18-trimethyl-5,6,9,10,13-pentamethylidene-2-prop-2-enoxydocosa-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 143772829 |
| Molecular Formula | C33H44F4O |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | (3Z,7Z,11Z)-3,4,11,12-tetrafluoro-14,17,18-trimethyl-5,6,9,10,13-pentamethylidene-2-prop-2-enoxydocosa-1,3,7,11-tetraene |
| SMILES | C=CCOC(=C)/C(F)=C(\F)C(=C)C(=C)/C=C\C(=C)C(=C)/C(F)=C(\F)C(=C)C(C)CCC(C)C(C)CCCC |
| InChI | InChI=1S/C33H44F4O/c1-12-14-15-21(3)22(4)16-17-23(5)26(8)30(34)31(35)27(9)24(6)18-19-25(7)28(10)32(36)33(37)29(11)38-20-13-2/h13,18-19,21-23H,2,6-12,14-17,20H2,1,3-5H3/b19-18-,31-30-,33-32- |
| InChIKey | DMEQWTAMCSVMMP-CRCSDPCMSA-N |
| XLogP | 11.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|