C23H32F4O2 — CID 143875080
but-1-ene;(3Z,11Z)-3,4,11,12-tetrafluoro-13-methoxy-6,9-dimethyl-5,10-dimethylidenetetradeca-1,3,11,13-tetraen-2-ol (PubChem CID 143875080) has the molecular formula C23H32F4O2 and a molecular weight of 416.50 g/mol. Its IUPAC name is but-1-ene;(3Z,11Z)-3,4,11,12-tetrafluoro-13-methoxy-6,9-dimethyl-5,10-dimethylidenetetradeca-1,3,11,13-tetraen-2-ol.
| Compound Name | but-1-ene;(3Z,11Z)-3,4,11,12-tetrafluoro-13-methoxy-6,9-dimethyl-5,10-dimethylidenetetradeca-1,3,11,13-tetraen-2-ol |
|---|---|
| PubChem CID | 143875080 |
| Molecular Formula | C23H32F4O2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | but-1-ene;(3Z,11Z)-3,4,11,12-tetrafluoro-13-methoxy-6,9-dimethyl-5,10-dimethylidenetetradeca-1,3,11,13-tetraen-2-ol |
| SMILES | C=C(O)/C(F)=C(/F)C(=C)C(C)CCC(C)C(=C)/C(F)=C(/F)C(=C)OC.C=CCC |
| InChI | InChI=1S/C19H24F4O2.C4H8/c1-10(12(3)16(20)18(22)14(5)24)8-9-11(2)13(4)17(21)19(23)15(6)25-7;1-3-4-2/h10-11,24H,3-6,8-9H2,1-2,7H3;3H,1,4H2,2H3/b18-16-,19-17-; |
| InChIKey | WZMJLNNQMWQUTF-BBJOEVDKSA-N |
| XLogP | 8.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|