C24H33F3O2 — CID 143875248
4-[(8Z)-8,9-difluoro-10-methoxy-3,6-dimethyl-7-methylideneundeca-8,10-dienyl]-3-fluorophenol;prop-1-ene (PubChem CID 143875248) has the molecular formula C24H33F3O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 4-[(8Z)-8,9-difluoro-10-methoxy-3,6-dimethyl-7-methylideneundeca-8,10-dienyl]-3-fluorophenol;prop-1-ene.
| Compound Name | 4-[(8Z)-8,9-difluoro-10-methoxy-3,6-dimethyl-7-methylideneundeca-8,10-dienyl]-3-fluorophenol;prop-1-ene |
|---|---|
| PubChem CID | 143875248 |
| Molecular Formula | C24H33F3O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 4-[(8Z)-8,9-difluoro-10-methoxy-3,6-dimethyl-7-methylideneundeca-8,10-dienyl]-3-fluorophenol;prop-1-ene |
| SMILES | C=C(OC)/C(F)=C(/F)C(=C)C(C)CCC(C)CCc1ccc(O)cc1F.C=CC |
| InChI | InChI=1S/C21H27F3O2.C3H6/c1-13(7-9-17-10-11-18(25)12-19(17)22)6-8-14(2)15(3)20(23)21(24)16(4)26-5;1-3-2/h10-14,25H,3-4,6-9H2,1-2,5H3;3H,1H2,2H3/b21-20-; |
| InChIKey | NJLGQUYYPSMCER-CFRCJOIHSA-N |
| XLogP | 7.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|