C22H28F4O — CID 143875032
1-[(8Z)-8,9-difluoro-10-methoxy-3,6-dimethyl-7-methylideneundeca-8,10-dienyl]-2,3-difluoro-4-methylbenzene (PubChem CID 143875032) has the molecular formula C22H28F4O and a molecular weight of 384.46 g/mol. Its IUPAC name is 1-[(8Z)-8,9-difluoro-10-methoxy-3,6-dimethyl-7-methylideneundeca-8,10-dienyl]-2,3-difluoro-4-methylbenzene.
| Compound Name | 1-[(8Z)-8,9-difluoro-10-methoxy-3,6-dimethyl-7-methylideneundeca-8,10-dienyl]-2,3-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 143875032 |
| Molecular Formula | C22H28F4O |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 1-[(8Z)-8,9-difluoro-10-methoxy-3,6-dimethyl-7-methylideneundeca-8,10-dienyl]-2,3-difluoro-4-methylbenzene |
| SMILES | C=C(OC)/C(F)=C(/F)C(=C)C(C)CCC(C)CCc1ccc(C)c(F)c1F |
| InChI | InChI=1S/C22H28F4O/c1-13(8-11-18-12-10-15(3)19(23)22(18)26)7-9-14(2)16(4)20(24)21(25)17(5)27-6/h10,12-14H,4-5,7-9,11H2,1-3,6H3/b21-20- |
| InChIKey | SOZCENODOMCDHI-MRCUWXFGSA-N |
| XLogP | 7.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|