C31H44F4O3 — CID 143908726
1-[(7Z)-7,8-difluoro-9-methoxy-2,5-dimethyl-6-methylidenedeca-7,9-dienoxy]-4-(4-ethoxycyclohexyl)-2,3-difluorobenzene;prop-1-ene (PubChem CID 143908726) has the molecular formula C31H44F4O3 and a molecular weight of 540.68 g/mol. Its IUPAC name is 1-[(7Z)-7,8-difluoro-9-methoxy-2,5-dimethyl-6-methylidenedeca-7,9-dienoxy]-4-(4-ethoxycyclohexyl)-2,3-difluorobenzene;prop-1-ene.
| Compound Name | 1-[(7Z)-7,8-difluoro-9-methoxy-2,5-dimethyl-6-methylidenedeca-7,9-dienoxy]-4-(4-ethoxycyclohexyl)-2,3-difluorobenzene;prop-1-ene |
|---|---|
| PubChem CID | 143908726 |
| Molecular Formula | C31H44F4O3 |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | 1-[(7Z)-7,8-difluoro-9-methoxy-2,5-dimethyl-6-methylidenedeca-7,9-dienoxy]-4-(4-ethoxycyclohexyl)-2,3-difluorobenzene;prop-1-ene |
| SMILES | C=C(OC)/C(F)=C(/F)C(=C)C(C)CCC(C)COc1ccc(C2CCC(OCC)CC2)c(F)c1F.C=CC |
| InChI | InChI=1S/C28H38F4O3.C3H6/c1-7-34-22-12-10-21(11-13-22)23-14-15-24(28(32)27(23)31)35-16-17(2)8-9-18(3)19(4)25(29)26(30)20(5)33-6;1-3-2/h14-15,17-18,21-22H,4-5,7-13,16H2,1-3,6H3;3H,1H2,2H3/b26-25-; |
| InChIKey | CTLGQHWTIHJFRQ-OQKDUQJOSA-N |
| XLogP | 9.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|