C31H42F4O2 — CID 143909069
but-1-ene;4-[4-[(8Z)-8,9-difluoro-10-methoxy-3,6-dimethyl-7-methylideneundeca-8,10-dienyl]-2,3-difluorophenyl]cyclohex-3-en-1-ol (PubChem CID 143909069) has the molecular formula C31H42F4O2 and a molecular weight of 522.67 g/mol. Its IUPAC name is but-1-ene;4-[4-[(8Z)-8,9-difluoro-10-methoxy-3,6-dimethyl-7-methylideneundeca-8,10-dienyl]-2,3-difluorophenyl]cyclohex-3-en-1-ol.
| Compound Name | but-1-ene;4-[4-[(8Z)-8,9-difluoro-10-methoxy-3,6-dimethyl-7-methylideneundeca-8,10-dienyl]-2,3-difluorophenyl]cyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 143909069 |
| Molecular Formula | C31H42F4O2 |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | but-1-ene;4-[4-[(8Z)-8,9-difluoro-10-methoxy-3,6-dimethyl-7-methylideneundeca-8,10-dienyl]-2,3-difluorophenyl]cyclohex-3-en-1-ol |
| SMILES | C=C(OC)/C(F)=C(/F)C(=C)C(C)CCC(C)CCc1ccc(C2=CCC(O)CC2)c(F)c1F.C=CCC |
| InChI | InChI=1S/C27H34F4O2.C4H8/c1-16(6-8-17(2)18(3)24(28)25(29)19(4)33-5)7-9-21-12-15-23(27(31)26(21)30)20-10-13-22(32)14-11-20;1-3-4-2/h10,12,15-17,22,32H,3-4,6-9,11,13-14H2,1-2,5H3;3H,1,4H2,2H3/b25-24-; |
| InChIKey | RMQOQZZIHPXRKK-BJFQDICYSA-N |
| XLogP | 9.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|