C22H28F4O2 — CID 143875352
1-[(8Z)-8,9-difluoro-10-methoxy-3,6-dimethyl-7-methylideneundeca-8,10-dienyl]-2,3-difluoro-4-methoxybenzene (PubChem CID 143875352) has the molecular formula C22H28F4O2 and a molecular weight of 400.46 g/mol. Its IUPAC name is 1-[(8Z)-8,9-difluoro-10-methoxy-3,6-dimethyl-7-methylideneundeca-8,10-dienyl]-2,3-difluoro-4-methoxybenzene.
| Compound Name | 1-[(8Z)-8,9-difluoro-10-methoxy-3,6-dimethyl-7-methylideneundeca-8,10-dienyl]-2,3-difluoro-4-methoxybenzene |
|---|---|
| PubChem CID | 143875352 |
| Molecular Formula | C22H28F4O2 |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 1-[(8Z)-8,9-difluoro-10-methoxy-3,6-dimethyl-7-methylideneundeca-8,10-dienyl]-2,3-difluoro-4-methoxybenzene |
| SMILES | C=C(OC)/C(F)=C(/F)C(=C)C(C)CCC(C)CCc1ccc(OC)c(F)c1F |
| InChI | InChI=1S/C22H28F4O2/c1-13(8-10-17-11-12-18(28-6)22(26)21(17)25)7-9-14(2)15(3)19(23)20(24)16(4)27-5/h11-14H,3-4,7-10H2,1-2,5-6H3/b20-19- |
| InChIKey | IGFFCAUAHXOYAA-VXPUYCOJSA-N |
| XLogP | 6.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|