C20H25F3O3 — CID 143875077
2,3-difluoro-4-[(7E)-7-fluoro-9-methoxy-2,5-dimethyl-6-methylidenedeca-7,9-dienoxy]phenol (PubChem CID 143875077) has the molecular formula C20H25F3O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2,3-difluoro-4-[(7E)-7-fluoro-9-methoxy-2,5-dimethyl-6-methylidenedeca-7,9-dienoxy]phenol.
| Compound Name | 2,3-difluoro-4-[(7E)-7-fluoro-9-methoxy-2,5-dimethyl-6-methylidenedeca-7,9-dienoxy]phenol |
|---|---|
| PubChem CID | 143875077 |
| Molecular Formula | C20H25F3O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 2,3-difluoro-4-[(7E)-7-fluoro-9-methoxy-2,5-dimethyl-6-methylidenedeca-7,9-dienoxy]phenol |
| SMILES | C=C(/C=C(/F)C(=C)C(C)CCC(C)COc1ccc(O)c(F)c1F)OC |
| InChI | InChI=1S/C20H25F3O3/c1-12(11-26-18-9-8-17(24)19(22)20(18)23)6-7-13(2)15(4)16(21)10-14(3)25-5/h8-10,12-13,24H,3-4,6-7,11H2,1-2,5H3/b16-10+ |
| InChIKey | YRTBSIAONNRVDV-MHWRWJLKSA-N |
| XLogP | 5.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|