C24H31F3O2 — CID 143875234
1-[(7E)-9-ethoxy-8-fluoro-2,5-dimethyl-6-methylidenedeca-7,9-dienoxy]-2,3-difluoro-4-[(E)-prop-1-enyl]benzene (PubChem CID 143875234) has the molecular formula C24H31F3O2 and a molecular weight of 408.50 g/mol. Its IUPAC name is 1-[(7E)-9-ethoxy-8-fluoro-2,5-dimethyl-6-methylidenedeca-7,9-dienoxy]-2,3-difluoro-4-[(E)-prop-1-enyl]benzene.
| Compound Name | 1-[(7E)-9-ethoxy-8-fluoro-2,5-dimethyl-6-methylidenedeca-7,9-dienoxy]-2,3-difluoro-4-[(E)-prop-1-enyl]benzene |
|---|---|
| PubChem CID | 143875234 |
| Molecular Formula | C24H31F3O2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 1-[(7E)-9-ethoxy-8-fluoro-2,5-dimethyl-6-methylidenedeca-7,9-dienoxy]-2,3-difluoro-4-[(E)-prop-1-enyl]benzene |
| SMILES | C=C(OCC)/C(F)=C\C(=C)C(C)CCC(C)COc1ccc(/C=C/C)c(F)c1F |
| InChI | InChI=1S/C24H31F3O2/c1-7-9-20-12-13-22(24(27)23(20)26)29-15-16(3)10-11-17(4)18(5)14-21(25)19(6)28-8-2/h7,9,12-14,16-17H,5-6,8,10-11,15H2,1-4H3/b9-7+,21-14+ |
| InChIKey | JMGHLXFIVMVCOI-PRTVPTKRSA-N |
| XLogP | 7.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|