C31H29F3O — CID 143909058
1-[(1E,4Z,8E)-10-ethoxy-8-fluoro-3,6,7-trimethylideneundeca-1,4,8,10-tetraenyl]-2,3-difluoro-4-[4-[(E)-prop-1-enyl]phenyl]benzene (PubChem CID 143909058) has the molecular formula C31H29F3O and a molecular weight of 474.57 g/mol. Its IUPAC name is 1-[(1E,4Z,8E)-10-ethoxy-8-fluoro-3,6,7-trimethylideneundeca-1,4,8,10-tetraenyl]-2,3-difluoro-4-[4-[(E)-prop-1-enyl]phenyl]benzene.
| Compound Name | 1-[(1E,4Z,8E)-10-ethoxy-8-fluoro-3,6,7-trimethylideneundeca-1,4,8,10-tetraenyl]-2,3-difluoro-4-[4-[(E)-prop-1-enyl]phenyl]benzene |
|---|---|
| PubChem CID | 143909058 |
| Molecular Formula | C31H29F3O |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 1-[(1E,4Z,8E)-10-ethoxy-8-fluoro-3,6,7-trimethylideneundeca-1,4,8,10-tetraenyl]-2,3-difluoro-4-[4-[(E)-prop-1-enyl]phenyl]benzene |
| SMILES | C=C(/C=C/C(=C)C(=C)/C(F)=C/C(=C)OCC)/C=C/c1ccc(-c2ccc(/C=C/C)cc2)c(F)c1F |
| InChI | InChI=1S/C31H29F3O/c1-7-9-25-13-16-26(17-14-25)28-19-18-27(30(33)31(28)34)15-11-21(3)10-12-22(4)24(6)29(32)20-23(5)35-8-2/h7,9-20H,3-6,8H2,1-2H3/b9-7+,12-10-,15-11+,29-20+ |
| InChIKey | NPWFQWISJZEKPU-XNQXJJFKSA-N |
| XLogP | 9.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|